About 4-anilinoadamantan-1-ol
4-anilinoadamantan-1-ol (PubChem CID 2847327) has the molecular formula C16H21NO
and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-anilinoadamantan-1-ol.
Molecular Properties
| Compound Name | 4-anilinoadamantan-1-ol |
| PubChem CID | 2847327 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 4-anilinoadamantan-1-ol |
| SMILES | OC12CC3CC(C1)C(Nc1ccccc1)C(C3)C2 |
| InChI | InChI=1S/C16H21NO/c18-16-8-11-6-12(9-16)15(13(7-11)10-16)17-14-4-2-1-3-5-14/h1-5,11-13,15,17-18H,6-10H2 |
| InChIKey | PVPAWNFWGQRKMU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-anilinoadamantan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilinoadamantan-1-ol?
The IUPAC name of 4-anilinoadamantan-1-ol (CID 2847327) is 4-anilinoadamantan-1-ol.
What is the SMILES notation for 4-anilinoadamantan-1-ol?
The canonical SMILES for 4-anilinoadamantan-1-ol is OC12CC3CC(C1)C(Nc1ccccc1)C(C3)C2.
What is the InChIKey of 4-anilinoadamantan-1-ol?
The InChIKey is PVPAWNFWGQRKMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO/c18-16-8-11-6-12(9-16)15(13(7-11)10-16)17-14-4-2-1-3-5-14/h1-5,11-13,15,17-18H,6-10H2.
What are the key properties of 4-anilinoadamantan-1-ol?
4-anilinoadamantan-1-ol has a molecular weight of 243.35 g/mol, XLogP of 3.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilinoadamantan-1-ol is sourced from PubChem (CID 2847327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).