About ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride
ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride (PubChem CID 2847331) has the molecular formula C16H23ClN2O5
and a molecular weight of 358.82 g/mol. Its IUPAC name is ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride |
| PubChem CID | 2847331 |
| Molecular Formula | C16H23ClN2O5 |
| Molecular Weight | 358.82 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride |
| SMILES | CCOC(=O)CCn1c(CC(=O)OCC)nc2ccccc21.Cl.O |
| InChI | InChI=1S/C16H20N2O4.ClH.H2O/c1-3-21-15(19)9-10-18-13-8-6-5-7-12(13)17-14(18)11-16(20)22-4-2;;/h5-8H,3-4,9-11H2,1-2H3;1H;1H2 |
| InChIKey | RFPAAYLVHMHELP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 101.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.82 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride?
The IUPAC name of ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride (CID 2847331) is ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride.
What is the SMILES notation for ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride?
The canonical SMILES for ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride is CCOC(=O)CCn1c(CC(=O)OCC)nc2ccccc21.Cl.O.
What is the InChIKey of ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride?
The InChIKey is RFPAAYLVHMHELP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O4.ClH.H2O/c1-3-21-15(19)9-10-18-13-8-6-5-7-12(13)17-14(18)11-16(20)22-4-2;;/h5-8H,3-4,9-11H2,1-2H3;1H;1H2.
What are the key properties of ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride?
ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride has a molecular weight of 358.82 g/mol, XLogP of 1.69, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-(2-ethoxy-2-oxoethyl)benzimidazol-1-yl]propanoate;hydrate;hydrochloride is sourced from PubChem (CID 2847331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).