About 4-hydroxy-TEMPO benzoate
4-hydroxy-TEMPO benzoate (PubChem CID 2847363) has the molecular formula C16H22NO3
and a molecular weight of 276.36 g/mol.
Molecular Properties
| Compound Name | 4-hydroxy-TEMPO benzoate |
| PubChem CID | 2847363 |
| Molecular Formula | C16H22NO3 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C16H22NO3/c1-15(2)10-13(11-16(3,4)17(15)19)20-14(18)12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3 |
| InChIKey | MJEDTBDGYVATPI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-TEMPO benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-TEMPO benzoate?
The IUPAC name of 4-hydroxy-TEMPO benzoate (CID 2847363) is not available.
What is the SMILES notation for 4-hydroxy-TEMPO benzoate?
The canonical SMILES for 4-hydroxy-TEMPO benzoate is CC1(C)CC(OC(=O)c2ccccc2)CC(C)(C)N1[O].
What is the InChIKey of 4-hydroxy-TEMPO benzoate?
The InChIKey is MJEDTBDGYVATPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22NO3/c1-15(2)10-13(11-16(3,4)17(15)19)20-14(18)12-8-6-5-7-9-12/h5-9,13H,10-11H2,1-4H3.
What are the key properties of 4-hydroxy-TEMPO benzoate?
4-hydroxy-TEMPO benzoate has a molecular weight of 276.36 g/mol, XLogP of 3.21, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-TEMPO benzoate is sourced from PubChem (CID 2847363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).