C19H16N2O3 — CID 2847380
2-tert-butyl-1H-naphtho[2,3-g]indazole-3,6,11-trione (PubChem CID 2847380) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-tert-butyl-1H-naphtho[2,3-g]indazole-3,6,11-trione.
| Compound Name | 2-tert-butyl-1H-naphtho[2,3-g]indazole-3,6,11-trione |
|---|---|
| PubChem CID | 2847380 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-tert-butyl-1H-naphtho[2,3-g]indazole-3,6,11-trione |
| SMILES | CC(C)(C)n1[nH]c2c3c(ccc2c1=O)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C19H16N2O3/c1-19(2,3)21-18(24)13-9-8-12-14(15(13)20-21)17(23)11-7-5-4-6-10(11)16(12)22/h4-9,20H,1-3H3 |
| InChIKey | WORUOLICSOMHPR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|