About 4,5-dimethylundecane
4,5-dimethylundecane (PubChem CID 28475) has the molecular formula C13H28
and a molecular weight of 184.37 g/mol. Its IUPAC name is 4,5-dimethylundecane.
Molecular Properties
| Compound Name | 4,5-dimethylundecane |
| PubChem CID | 28475 |
| Molecular Formula | C13H28 |
| Molecular Weight | 184.37 g/mol |
| Exact Mass | 184.22 |
| IUPAC Name | 4,5-dimethylundecane |
| SMILES | CCCCCCC(C)C(C)CCC |
| InChI | InChI=1S/C13H28/c1-5-7-8-9-11-13(4)12(3)10-6-2/h12-13H,5-11H2,1-4H3 |
| InChIKey | MYUGNKWRNJTZRU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 184.37 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethylundecane?
The IUPAC name of 4,5-dimethylundecane (CID 28475) is 4,5-dimethylundecane.
What is the SMILES notation for 4,5-dimethylundecane?
The canonical SMILES for 4,5-dimethylundecane is CCCCCCC(C)C(C)CCC.
What is the InChIKey of 4,5-dimethylundecane?
The InChIKey is MYUGNKWRNJTZRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28/c1-5-7-8-9-11-13(4)12(3)10-6-2/h12-13H,5-11H2,1-4H3.
What are the key properties of 4,5-dimethylundecane?
4,5-dimethylundecane has a molecular weight of 184.37 g/mol, XLogP of 5.03, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethylundecane is sourced from PubChem (CID 28475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).