About 9-chloro-1-methyl-1,10-phenanthrolin-2-one
9-chloro-1-methyl-1,10-phenanthrolin-2-one (PubChem CID 2847540) has the molecular formula C13H9ClN2O
and a molecular weight of 244.68 g/mol. Its IUPAC name is 9-chloro-1-methyl-1,10-phenanthrolin-2-one.
Molecular Properties
| Compound Name | 9-chloro-1-methyl-1,10-phenanthrolin-2-one |
| PubChem CID | 2847540 |
| Molecular Formula | C13H9ClN2O |
| Molecular Weight | 244.68 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 9-chloro-1-methyl-1,10-phenanthrolin-2-one |
| SMILES | Cn1c(=O)ccc2ccc3ccc(Cl)nc3c21 |
| InChI | InChI=1S/C13H9ClN2O/c1-16-11(17)7-5-9-3-2-8-4-6-10(14)15-12(8)13(9)16/h2-7H,1H3 |
| InChIKey | YXXDYYVBJXXVFC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.68 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 9-chloro-1-methyl-1,10-phenanthrolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-1-methyl-1,10-phenanthrolin-2-one?
The IUPAC name of 9-chloro-1-methyl-1,10-phenanthrolin-2-one (CID 2847540) is 9-chloro-1-methyl-1,10-phenanthrolin-2-one.
What is the SMILES notation for 9-chloro-1-methyl-1,10-phenanthrolin-2-one?
The canonical SMILES for 9-chloro-1-methyl-1,10-phenanthrolin-2-one is Cn1c(=O)ccc2ccc3ccc(Cl)nc3c21.
What is the InChIKey of 9-chloro-1-methyl-1,10-phenanthrolin-2-one?
The InChIKey is YXXDYYVBJXXVFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN2O/c1-16-11(17)7-5-9-3-2-8-4-6-10(14)15-12(8)13(9)16/h2-7H,1H3.
What are the key properties of 9-chloro-1-methyl-1,10-phenanthrolin-2-one?
9-chloro-1-methyl-1,10-phenanthrolin-2-one has a molecular weight of 244.68 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-1-methyl-1,10-phenanthrolin-2-one is sourced from PubChem (CID 2847540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).