C13H9Br3ClNO — CID 2847599
1-(4-chlorophenyl)-2-(3,5-dibromopyridin-1-ium-1-yl)ethanone bromide (PubChem CID 2847599) has the molecular formula C13H9Br3ClNO and a molecular weight of 470.39 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(3,5-dibromopyridin-1-ium-1-yl)ethanone bromide.
| Compound Name | 1-(4-chlorophenyl)-2-(3,5-dibromopyridin-1-ium-1-yl)ethanone bromide |
|---|---|
| PubChem CID | 2847599 |
| Molecular Formula | C13H9Br3ClNO |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 466.79 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(3,5-dibromopyridin-1-ium-1-yl)ethanone bromide |
| SMILES | O=C(C[n+]1cc(Br)cc(Br)c1)c1ccc(Cl)cc1.[Br-] |
| InChI | InChI=1S/C13H9Br2ClNO.BrH/c14-10-5-11(15)7-17(6-10)8-13(18)9-1-3-12(16)4-2-9;/h1-7H,8H2;1H/q+1;/p-1 |
| InChIKey | QUZNPAIETZBNSL-UHFFFAOYSA-M |
| XLogP | 1.04 |
| TPSA | 20.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|