About 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde
1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde (PubChem CID 2847629) has the molecular formula C20H19NO2
and a molecular weight of 305.38 g/mol. Its IUPAC name is 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde.
Molecular Properties
| Compound Name | 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde |
| PubChem CID | 2847629 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1cc(C=O)ccc1O2 |
| InChI | InChI=1S/C20H19NO2/c1-19(2)16-6-4-5-7-17(16)21(3)20(19)11-10-15-12-14(13-22)8-9-18(15)23-20/h4-13H,1-3H3 |
| InChIKey | VTYYJHDETHHNEN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde?
The IUPAC name of 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde (CID 2847629) is 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde.
What is the SMILES notation for 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde?
The canonical SMILES for 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde is CN1c2ccccc2C(C)(C)C12C=Cc1cc(C=O)ccc1O2.
What is the InChIKey of 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde?
The InChIKey is VTYYJHDETHHNEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO2/c1-19(2)16-6-4-5-7-17(16)21(3)20(19)11-10-15-12-14(13-22)8-9-18(15)23-20/h4-13H,1-3H3.
What are the key properties of 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde?
1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde has a molecular weight of 305.38 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-carbaldehyde is sourced from PubChem (CID 2847629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).