About 1-diazoanthracene-2,9,10-trione
1-diazoanthracene-2,9,10-trione (PubChem CID 2847693) has the molecular formula C14H6N2O3
and a molecular weight of 250.21 g/mol. Its IUPAC name is 1-diazoanthracene-2,9,10-trione.
Molecular Properties
| Compound Name | 1-diazoanthracene-2,9,10-trione |
| PubChem CID | 2847693 |
| Molecular Formula | C14H6N2O3 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 1-diazoanthracene-2,9,10-trione |
| SMILES | [N-]=[N+]=c1c(=O)ccc2c(=O)c3ccccc3c(=O)c1=2 |
| InChI | InChI=1S/C14H6N2O3/c15-16-12-10(17)6-5-9-11(12)14(19)8-4-2-1-3-7(8)13(9)18/h1-6H |
| InChIKey | INLHLEQFCWNMOK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1-diazoanthracene-2,9,10-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diazoanthracene-2,9,10-trione?
The IUPAC name of 1-diazoanthracene-2,9,10-trione (CID 2847693) is 1-diazoanthracene-2,9,10-trione.
What is the SMILES notation for 1-diazoanthracene-2,9,10-trione?
The canonical SMILES for 1-diazoanthracene-2,9,10-trione is [N-]=[N+]=c1c(=O)ccc2c(=O)c3ccccc3c(=O)c1=2.
What is the InChIKey of 1-diazoanthracene-2,9,10-trione?
The InChIKey is INLHLEQFCWNMOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6N2O3/c15-16-12-10(17)6-5-9-11(12)14(19)8-4-2-1-3-7(8)13(9)18/h1-6H.
What are the key properties of 1-diazoanthracene-2,9,10-trione?
1-diazoanthracene-2,9,10-trione has a molecular weight of 250.21 g/mol, XLogP of -0.35, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diazoanthracene-2,9,10-trione is sourced from PubChem (CID 2847693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).