About 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate
3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate (PubChem CID 2847717) has the molecular formula C27H43NO3
and a molecular weight of 429.65 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate.
Molecular Properties
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate |
| PubChem CID | 2847717 |
| Molecular Formula | C27H43NO3 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.32 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate |
| SMILES | CC(=CC(=O)OCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)NC1CCCCC1 |
| InChI | InChI=1S/C27H43NO3/c1-19(28-21-13-9-8-10-14-21)16-24(29)31-15-11-12-20-17-22(26(2,3)4)25(30)23(18-20)27(5,6)7/h16-18,21,28,30H,8-15H2,1-7H3 |
| InChIKey | SZCHISYMFDBRPY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate?
The IUPAC name of 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate (CID 2847717) is 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate.
What is the SMILES notation for 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate?
The canonical SMILES for 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate is CC(=CC(=O)OCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)NC1CCCCC1.
What is the InChIKey of 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate?
The InChIKey is SZCHISYMFDBRPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H43NO3/c1-19(28-21-13-9-8-10-14-21)16-24(29)31-15-11-12-20-17-22(26(2,3)4)25(30)23(18-20)27(5,6)7/h16-18,21,28,30H,8-15H2,1-7H3.
What are the key properties of 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate?
3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate has a molecular weight of 429.65 g/mol, XLogP of 6.29, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl 3-(cyclohexylamino)but-2-enoate is sourced from PubChem (CID 2847717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).