C21H18N2O3 — CID 2847852
2-cyclohexyl-1H-naphtho[2,3-g]indazole-3,6,11-trione (PubChem CID 2847852) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 2-cyclohexyl-1H-naphtho[2,3-g]indazole-3,6,11-trione.
| Compound Name | 2-cyclohexyl-1H-naphtho[2,3-g]indazole-3,6,11-trione |
|---|---|
| PubChem CID | 2847852 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-cyclohexyl-1H-naphtho[2,3-g]indazole-3,6,11-trione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1c(=O)n(C3CCCCC3)[nH]c21 |
| InChI | InChI=1S/C21H18N2O3/c24-19-13-8-4-5-9-14(13)20(25)17-15(19)10-11-16-18(17)22-23(21(16)26)12-6-2-1-3-7-12/h4-5,8-12,22H,1-3,6-7H2 |
| InChIKey | PGBGUZRKFRBNBT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|