C35H20N2O13 — CID 2848150
5-acetyloxy-2-[5-[2-(4-acetyloxy-2-carboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoic acid (PubChem CID 2848150) has the molecular formula C35H20N2O13 and a molecular weight of 676.55 g/mol. Its IUPAC name is 5-acetyloxy-2-[5-[2-(4-acetyloxy-2-carboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoic acid.
| Compound Name | 5-acetyloxy-2-[5-[2-(4-acetyloxy-2-carboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 2848150 |
| Molecular Formula | C35H20N2O13 |
| Molecular Weight | 676.55 g/mol |
| Exact Mass | 676.10 |
| IUPAC Name | 5-acetyloxy-2-[5-[2-(4-acetyloxy-2-carboxyphenyl)-1,3-dioxoisoindole-5-carbonyl]-1,3-dioxoisoindol-2-yl]benzoic acid |
| SMILES | CC(=O)Oc1ccc(N2C(=O)c3ccc(C(=O)c4ccc5c(c4)C(=O)N(c4ccc(OC(C)=O)cc4C(=O)O)C5=O)cc3C2=O)c(C(=O)O)c1 |
| InChI | InChI=1S/C35H20N2O13/c1-15(38)49-19-5-9-27(25(13-19)34(45)46)36-30(41)21-7-3-17(11-23(21)32(36)43)29(40)18-4-8-22-24(12-18)33(44)37(31(22)42)28-10-6-20(50-16(2)39)14-26(28)35(47)48/h3-14H,1-2H3,(H,45,46)(H,47,48) |
| InChIKey | NZZJZOMUSWCWIM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 219.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|