C23H29NO7 — CID 2848254
2-methoxyethyl 2-methyl-5-oxo-4-(2,3,4-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 2848254) has the molecular formula C23H29NO7 and a molecular weight of 431.49 g/mol. Its IUPAC name is 2-methoxyethyl 2-methyl-5-oxo-4-(2,3,4-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | 2-methoxyethyl 2-methyl-5-oxo-4-(2,3,4-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 2848254 |
| Molecular Formula | C23H29NO7 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 2-methoxyethyl 2-methyl-5-oxo-4-(2,3,4-trimethoxyphenyl)-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COCCOC(=O)C1=C(C)NC2=C(C(=O)CCC2)C1c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C23H29NO7/c1-13-18(23(26)31-12-11-27-2)19(20-15(24-13)7-6-8-16(20)25)14-9-10-17(28-3)22(30-5)21(14)29-4/h9-10,19,24H,6-8,11-12H2,1-5H3 |
| InChIKey | OQCPDKWVQQHIGJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|