C28H22N2O8 — CID 2849015
methyl 4-[10-(4-methoxycarbonylphenyl)-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl]benzoate (PubChem CID 2849015) has the molecular formula C28H22N2O8 and a molecular weight of 514.49 g/mol. Its IUPAC name is methyl 4-[10-(4-methoxycarbonylphenyl)-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl]benzoate.
| Compound Name | methyl 4-[10-(4-methoxycarbonylphenyl)-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl]benzoate |
|---|---|
| PubChem CID | 2849015 |
| Molecular Formula | C28H22N2O8 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | methyl 4-[10-(4-methoxycarbonylphenyl)-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)C3C4C=CC(C3C2=O)C2C(=O)N(c3ccc(C(=O)OC)cc3)C(=O)C42)cc1 |
| InChI | InChI=1S/C28H22N2O8/c1-37-27(35)13-3-7-15(8-4-13)29-23(31)19-17-11-12-18(20(19)24(29)32)22-21(17)25(33)30(26(22)34)16-9-5-14(6-10-16)28(36)38-2/h3-12,17-22H,1-2H3 |
| InChIKey | PSNZGZHDZOWGKK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|