About 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol
2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol (PubChem CID 2849165) has the molecular formula C18H21N3O4
and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol.
Molecular Properties
| Compound Name | 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol |
| PubChem CID | 2849165 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol |
| SMILES | CC1OC(Nc2ccc(/N=N/c3ccccc3)cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C18H21N3O4/c1-11-15(22)16(23)17(24)18(25-11)19-12-7-9-14(10-8-12)21-20-13-5-3-2-4-6-13/h2-11,15-19,22-24H,1H3/b21-20+ |
| InChIKey | XGASUXNFWLJGAS-QZQOTICOSA-N |
| XLogP | 2.34 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol?
The IUPAC name of 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol (CID 2849165) is 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol.
What is the SMILES notation for 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol?
The canonical SMILES for 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol is CC1OC(Nc2ccc(/N=N/c3ccccc3)cc2)C(O)C(O)C1O.
What is the InChIKey of 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol?
The InChIKey is XGASUXNFWLJGAS-QZQOTICOSA-N. The full InChI is InChI=1S/C18H21N3O4/c1-11-15(22)16(23)17(24)18(25-11)19-12-7-9-14(10-8-12)21-20-13-5-3-2-4-6-13/h2-11,15-19,22-24H,1H3/b21-20+.
What are the key properties of 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol?
2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol has a molecular weight of 343.38 g/mol, XLogP of 2.34, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(4-phenyldiazenylanilino)oxane-3,4,5-triol is sourced from PubChem (CID 2849165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).