About [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate
[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate (PubChem CID 2849198) has the molecular formula C11H11N5O3
and a molecular weight of 261.24 g/mol. Its IUPAC name is [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate.
Molecular Properties
| Compound Name | [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate |
| PubChem CID | 2849198 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)ON=C(N)c2nonc2N)cc1 |
| InChI | InChI=1S/C11H11N5O3/c1-6-2-4-7(5-3-6)11(17)18-15-9(12)8-10(13)16-19-14-8/h2-5H,1H3,(H2,12,15)(H2,13,16) |
| InChIKey | SKRRICRMAHOXOU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate?
The IUPAC name of [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate (CID 2849198) is [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate.
What is the SMILES notation for [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate?
The canonical SMILES for [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate is Cc1ccc(C(=O)ON=C(N)c2nonc2N)cc1.
What is the InChIKey of [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate?
The InChIKey is SKRRICRMAHOXOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5O3/c1-6-2-4-7(5-3-6)11(17)18-15-9(12)8-10(13)16-19-14-8/h2-5H,1H3,(H2,12,15)(H2,13,16).
What are the key properties of [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate?
[[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate has a molecular weight of 261.24 g/mol, XLogP of 0.44, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-(4-amino-1,2,5-oxadiazol-3-yl)methylidene]amino] 4-methylbenzoate is sourced from PubChem (CID 2849198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).