About ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride
ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride (PubChem CID 2849237) has the molecular formula C12H17ClN2O4
and a molecular weight of 288.73 g/mol. Its IUPAC name is ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride |
| PubChem CID | 2849237 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride |
| SMILES | CCOC(=O)CCCNC(=O)c1cncc(O)c1.Cl |
| InChI | InChI=1S/C12H16N2O4.ClH/c1-2-18-11(16)4-3-5-14-12(17)9-6-10(15)8-13-7-9;/h6-8,15H,2-5H2,1H3,(H,14,17);1H |
| InChIKey | POBXCAMFHIQAFS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride?
The IUPAC name of ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride (CID 2849237) is ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride.
What is the SMILES notation for ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride?
The canonical SMILES for ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride is CCOC(=O)CCCNC(=O)c1cncc(O)c1.Cl.
What is the InChIKey of ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride?
The InChIKey is POBXCAMFHIQAFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4.ClH/c1-2-18-11(16)4-3-5-14-12(17)9-6-10(15)8-13-7-9;/h6-8,15H,2-5H2,1H3,(H,14,17);1H.
What are the key properties of ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride?
ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride has a molecular weight of 288.73 g/mol, XLogP of 1.28, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(5-hydroxypyridine-3-carbonyl)amino]butanoate;hydrochloride is sourced from PubChem (CID 2849237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).