C22F16S2 — CID 2849409
1,2,4,5,6,8-hexafluoro-3,7-bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]naphthalene (PubChem CID 2849409) has the molecular formula C22F16S2 and a molecular weight of 632.34 g/mol. Its IUPAC name is 1,2,4,5,6,8-hexafluoro-3,7-bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]naphthalene.
| Compound Name | 1,2,4,5,6,8-hexafluoro-3,7-bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]naphthalene |
|---|---|
| PubChem CID | 2849409 |
| Molecular Formula | C22F16S2 |
| Molecular Weight | 632.34 g/mol |
| Exact Mass | 631.92 |
| IUPAC Name | 1,2,4,5,6,8-hexafluoro-3,7-bis[(2,3,4,5,6-pentafluorophenyl)sulfanyl]naphthalene |
| SMILES | Fc1c(F)c(F)c(Sc2c(F)c(F)c3c(F)c(Sc4c(F)c(F)c(F)c(F)c4F)c(F)c(F)c3c2F)c(F)c1F |
| InChI | InChI=1S/C22F16S2/c23-3-1-2(6(26)20(13(3)33)40-22-17(37)11(31)8(28)12(32)18(22)38)4(24)14(34)19(5(1)25)39-21-15(35)9(29)7(27)10(30)16(21)36 |
| InChIKey | YEDFUPRVYVDBMQ-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.34 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|