About N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide
N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide (PubChem CID 2849922) has the molecular formula C11H15N3O3
and a molecular weight of 237.26 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide.
Molecular Properties
| Compound Name | N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide |
| PubChem CID | 2849922 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide |
| SMILES | O=C(NCCCO)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C11H15N3O3/c15-7-3-6-13-10(16)11(17)14-8-9-4-1-2-5-12-9/h1-2,4-5,15H,3,6-8H2,(H,13,16)(H,14,17) |
| InChIKey | AXUJOSRNBLNROU-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide?
The IUPAC name of N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide (CID 2849922) is N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide.
What is the SMILES notation for N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide?
The canonical SMILES for N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide is O=C(NCCCO)C(=O)NCc1ccccn1.
What is the InChIKey of N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide?
The InChIKey is AXUJOSRNBLNROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3/c15-7-3-6-13-10(16)11(17)14-8-9-4-1-2-5-12-9/h1-2,4-5,15H,3,6-8H2,(H,13,16)(H,14,17).
What are the key properties of N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide?
N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide has a molecular weight of 237.26 g/mol, XLogP of -0.80, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxypropyl)-N'-(pyridin-2-ylmethyl)oxamide is sourced from PubChem (CID 2849922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).