C11H10Cl2N4O4 — CID 2850152
1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)propan-1-one;nitric acid (PubChem CID 2850152) has the molecular formula C11H10Cl2N4O4 and a molecular weight of 333.13 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)propan-1-one;nitric acid.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)propan-1-one;nitric acid |
|---|---|
| PubChem CID | 2850152 |
| Molecular Formula | C11H10Cl2N4O4 |
| Molecular Weight | 333.13 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(1,2,4-triazol-1-yl)propan-1-one;nitric acid |
| SMILES | CC(C(=O)c1ccc(Cl)cc1Cl)n1cncn1.O=[N+]([O-])O |
| InChI | InChI=1S/C11H9Cl2N3O.HNO3/c1-7(16-6-14-5-15-16)11(17)9-3-2-8(12)4-10(9)13;2-1(3)4/h2-7H,1H3;(H,2,3,4) |
| InChIKey | QMPJVDXKTAHRPT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.13 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|