C20H11Cl4N3O4 — CID 2850372
2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4-nitrophenyl]benzamide (PubChem CID 2850372) has the molecular formula C20H11Cl4N3O4 and a molecular weight of 499.14 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4-nitrophenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4-nitrophenyl]benzamide |
|---|---|
| PubChem CID | 2850372 |
| Molecular Formula | C20H11Cl4N3O4 |
| Molecular Weight | 499.14 g/mol |
| Exact Mass | 496.95 |
| IUPAC Name | 2,4-dichloro-N-[3-[(2,4-dichlorobenzoyl)amino]-4-nitrophenyl]benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])c(NC(=O)c2ccc(Cl)cc2Cl)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H11Cl4N3O4/c21-10-1-4-13(15(23)7-10)19(28)25-12-3-6-18(27(30)31)17(9-12)26-20(29)14-5-2-11(22)8-16(14)24/h1-9H,(H,25,28)(H,26,29) |
| InChIKey | IYFNAQXFOGZKPJ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.14 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|