C24H24N2OS — CID 2850448
5-phenyl-1-[4-(4,6,6-trimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)phenyl]penta-2,4-dien-1-one (PubChem CID 2850448) has the molecular formula C24H24N2OS and a molecular weight of 388.54 g/mol. Its IUPAC name is 5-phenyl-1-[4-(4,6,6-trimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)phenyl]penta-2,4-dien-1-one.
| Compound Name | 5-phenyl-1-[4-(4,6,6-trimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)phenyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 2850448 |
| Molecular Formula | C24H24N2OS |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 5-phenyl-1-[4-(4,6,6-trimethyl-2-sulfanylidene-1H-pyrimidin-3-yl)phenyl]penta-2,4-dien-1-one |
| SMILES | CC1=CC(C)(C)NC(=S)N1c1ccc(C(=O)C=CC=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2OS/c1-18-17-24(2,3)25-23(28)26(18)21-15-13-20(14-16-21)22(27)12-8-7-11-19-9-5-4-6-10-19/h4-17H,1-3H3,(H,25,28) |
| InChIKey | BFHHVOWJGPSOOJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|