About propan-2-yl 2-isocyanatoacetate
propan-2-yl 2-isocyanatoacetate (PubChem CID 28505671) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is propan-2-yl 2-isocyanatoacetate.
Molecular Properties
| Compound Name | propan-2-yl 2-isocyanatoacetate |
| PubChem CID | 28505671 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | propan-2-yl 2-isocyanatoacetate |
| SMILES | CC(C)OC(=O)CN=C=O |
| InChI | InChI=1S/C6H9NO3/c1-5(2)10-6(9)3-7-4-8/h5H,3H2,1-2H3 |
| InChIKey | KWNFHSIELNQHAL-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl 2-isocyanatoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-isocyanatoacetate?
The IUPAC name of propan-2-yl 2-isocyanatoacetate (CID 28505671) is propan-2-yl 2-isocyanatoacetate.
What is the SMILES notation for propan-2-yl 2-isocyanatoacetate?
The canonical SMILES for propan-2-yl 2-isocyanatoacetate is CC(C)OC(=O)CN=C=O.
What is the InChIKey of propan-2-yl 2-isocyanatoacetate?
The InChIKey is KWNFHSIELNQHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-5(2)10-6(9)3-7-4-8/h5H,3H2,1-2H3.
What are the key properties of propan-2-yl 2-isocyanatoacetate?
propan-2-yl 2-isocyanatoacetate has a molecular weight of 143.14 g/mol, XLogP of 0.27, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-isocyanatoacetate is sourced from PubChem (CID 28505671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).