C9H16N2O4 — CID 2850820
1,4-dimethoxy-5,5,6-trimethylpiperazine-2,3-dione (PubChem CID 2850820) has the molecular formula C9H16N2O4 and a molecular weight of 216.24 g/mol. Its IUPAC name is 1,4-dimethoxy-5,5,6-trimethylpiperazine-2,3-dione.
| Compound Name | 1,4-dimethoxy-5,5,6-trimethylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 2850820 |
| Molecular Formula | C9H16N2O4 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1,4-dimethoxy-5,5,6-trimethylpiperazine-2,3-dione |
| SMILES | CON1C(=O)C(=O)N(OC)C(C)(C)C1C |
| InChI | InChI=1S/C9H16N2O4/c1-6-9(2,3)11(15-5)8(13)7(12)10(6)14-4/h6H,1-5H3 |
| InChIKey | ATBUJAYGIFCHSC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|