About N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide
N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide (PubChem CID 2850965) has the molecular formula C9H13NO5S2
and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide |
| PubChem CID | 2850965 |
| Molecular Formula | C9H13NO5S2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide |
| SMILES | O=S1(=O)CCC(S(=O)(=O)NCc2ccco2)C1 |
| InChI | InChI=1S/C9H13NO5S2/c11-16(12)5-3-9(7-16)17(13,14)10-6-8-2-1-4-15-8/h1-2,4,9-10H,3,5-7H2 |
| InChIKey | SRZOHADVGILVRG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide?
The IUPAC name of N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide (CID 2850965) is N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide.
What is the SMILES notation for N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide?
The canonical SMILES for N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide is O=S1(=O)CCC(S(=O)(=O)NCc2ccco2)C1.
What is the InChIKey of N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide?
The InChIKey is SRZOHADVGILVRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO5S2/c11-16(12)5-3-9(7-16)17(13,14)10-6-8-2-1-4-15-8/h1-2,4,9-10H,3,5-7H2.
What are the key properties of N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide?
N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide has a molecular weight of 279.34 g/mol, XLogP of -0.11, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-1,1-dioxothiolane-3-sulfonamide is sourced from PubChem (CID 2850965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).