About 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid
3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid (PubChem CID 28510653) has the molecular formula C8H14N2O5S
and a molecular weight of 250.28 g/mol. Its IUPAC name is 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid |
| PubChem CID | 28510653 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)N[C@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H14N2O5S/c11-7(12)1-3-9-8(13)10-6-2-4-16(14,15)5-6/h6H,1-5H2,(H,11,12)(H2,9,10,13)/t6-/m0/s1 |
| InChIKey | QOXDKKYEDYITQK-LURJTMIESA-N |
| XLogP | -1.05 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid?
The IUPAC name of 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid (CID 28510653) is 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid.
What is the SMILES notation for 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid?
The canonical SMILES for 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid is O=C(O)CCNC(=O)N[C@H]1CCS(=O)(=O)C1.
What is the InChIKey of 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid?
The InChIKey is QOXDKKYEDYITQK-LURJTMIESA-N. The full InChI is InChI=1S/C8H14N2O5S/c11-7(12)1-3-9-8(13)10-6-2-4-16(14,15)5-6/h6H,1-5H2,(H,11,12)(H2,9,10,13)/t6-/m0/s1.
What are the key properties of 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid?
3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid has a molecular weight of 250.28 g/mol, XLogP of -1.05, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3S)-1,1-dioxothiolan-3-yl]carbamoylamino]propanoic acid is sourced from PubChem (CID 28510653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).