C38H28N6O4 — CID 2851149
2,6-bis[5-methyl-2-[(4-methylphenyl)diazenyl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 2851149) has the molecular formula C38H28N6O4 and a molecular weight of 632.68 g/mol. Its IUPAC name is 2,6-bis[5-methyl-2-[(4-methylphenyl)diazenyl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[5-methyl-2-[(4-methylphenyl)diazenyl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 2851149 |
| Molecular Formula | C38H28N6O4 |
| Molecular Weight | 632.68 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | 2,6-bis[5-methyl-2-[(4-methylphenyl)diazenyl]phenyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | Cc1ccc(/N=N/c2ccc(C)cc2-n2c(=O)c3cc4c(=O)n(-c5cc(C)ccc5/N=N/c5ccc(C)cc5)c(=O)c4cc3c2=O)cc1 |
| InChI | InChI=1S/C38H28N6O4/c1-21-5-11-25(12-6-21)39-41-31-15-9-23(3)17-33(31)43-35(45)27-19-29-30(20-28(27)36(43)46)38(48)44(37(29)47)34-18-24(4)10-16-32(34)42-40-26-13-7-22(2)8-14-26/h5-20H,1-4H3/b41-39+,42-40+ |
| InChIKey | GGBNUSXRNVKWLT-LMXNTIJMSA-N |
| XLogP | 7.96 |
| TPSA | 127.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.68 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|