About 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide
2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide (PubChem CID 2851193) has the molecular formula C22H20Cl2N2O3S
and a molecular weight of 463.39 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide |
| PubChem CID | 2851193 |
| Molecular Formula | C22H20Cl2N2O3S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide |
| SMILES | CC(NC(=O)CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20Cl2N2O3S/c1-16(17-8-4-2-5-9-17)25-22(27)15-26(21-13-12-18(23)14-20(21)24)30(28,29)19-10-6-3-7-11-19/h2-14,16H,15H2,1H3,(H,25,27) |
| InChIKey | ZNNNCQQLEYKADQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide?
The IUPAC name of 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide (CID 2851193) is 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide.
What is the SMILES notation for 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide?
The canonical SMILES for 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide is CC(NC(=O)CN(c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide?
The InChIKey is ZNNNCQQLEYKADQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20Cl2N2O3S/c1-16(17-8-4-2-5-9-17)25-22(27)15-26(21-13-12-18(23)14-20(21)24)30(28,29)19-10-6-3-7-11-19/h2-14,16H,15H2,1H3,(H,25,27).
What are the key properties of 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide?
2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide has a molecular weight of 463.39 g/mol, XLogP of 5.07, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[N-(benzenesulfonyl)-2,4-dichloroanilino]-N-(1-phenylethyl)acetamide is sourced from PubChem (CID 2851193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).