C17H7F8NO — CID 2851238
2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)-1-quinolin-6-ylethanol (PubChem CID 2851238) has the molecular formula C17H7F8NO and a molecular weight of 393.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)-1-quinolin-6-ylethanol.
| Compound Name | 2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)-1-quinolin-6-ylethanol |
|---|---|
| PubChem CID | 2851238 |
| Molecular Formula | C17H7F8NO |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 2,2,2-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)-1-quinolin-6-ylethanol |
| SMILES | OC(c1ccc2ncccc2c1)(c1c(F)c(F)c(F)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C17H7F8NO/c18-11-10(12(19)14(21)15(22)13(11)20)16(27,17(23,24)25)8-3-4-9-7(6-8)2-1-5-26-9/h1-6,27H |
| InChIKey | RBIQKVOJNSGRLQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|