C12H16FNO4S — CID 28513599
4-[2-(4-fluorophenyl)ethylsulfamoyl]butanoic acid (PubChem CID 28513599) has the molecular formula C12H16FNO4S and a molecular weight of 289.33 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)ethylsulfamoyl]butanoic acid.
| Compound Name | 4-[2-(4-fluorophenyl)ethylsulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 28513599 |
| Molecular Formula | C12H16FNO4S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-[2-(4-fluorophenyl)ethylsulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C12H16FNO4S/c13-11-5-3-10(4-6-11)7-8-14-19(17,18)9-1-2-12(15)16/h3-6,14H,1-2,7-9H2,(H,15,16) |
| InChIKey | OSGYTGCIUXSPQJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |