About 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane
5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane (PubChem CID 28514) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane.
Analyze 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane?
The IUPAC name of 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane (CID 28514) is 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane.
What is the SMILES notation for 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane?
The canonical SMILES for 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane is CCC1(CCOC)COC(C(C)C)OC1.
What is the InChIKey of 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane?
The InChIKey is DLDWSRMEZOEAGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-5-12(6-7-13-4)8-14-11(10(2)3)15-9-12/h10-11H,5-9H2,1-4H3.
What are the key properties of 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane?
5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane has a molecular weight of 216.32 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-5-(2-methoxyethyl)-2-propan-2-yl-1,3-dioxane is sourced from PubChem (CID 28514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).