About (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone
(4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone (PubChem CID 2851560) has the molecular formula C13H16BrNO2
and a molecular weight of 298.18 g/mol. Its IUPAC name is (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone.
Molecular Properties
| Compound Name | (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone |
| PubChem CID | 2851560 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1CN(C(=O)c2ccc(Br)cc2)CC(C)O1 |
| InChI | InChI=1S/C13H16BrNO2/c1-9-7-15(8-10(2)17-9)13(16)11-3-5-12(14)6-4-11/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | CXDKMPZHGSWYOF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone?
The IUPAC name of (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone (CID 2851560) is (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone.
What is the SMILES notation for (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone?
The canonical SMILES for (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone is CC1CN(C(=O)c2ccc(Br)cc2)CC(C)O1.
What is the InChIKey of (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone?
The InChIKey is CXDKMPZHGSWYOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16BrNO2/c1-9-7-15(8-10(2)17-9)13(16)11-3-5-12(14)6-4-11/h3-6,9-10H,7-8H2,1-2H3.
What are the key properties of (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone?
(4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone has a molecular weight of 298.18 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl)-(2,6-dimethylmorpholin-4-yl)methanone is sourced from PubChem (CID 2851560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).