About (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea
(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea (PubChem CID 2851929) has the molecular formula C10H11N3O3S
and a molecular weight of 253.28 g/mol. Its IUPAC name is (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea.
Molecular Properties
| Compound Name | (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea |
| PubChem CID | 2851929 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea |
| SMILES | NC(=S)NNC(=O)C1COc2ccccc2O1 |
| InChI | InChI=1S/C10H11N3O3S/c11-10(17)13-12-9(14)8-5-15-6-3-1-2-4-7(6)16-8/h1-4,8H,5H2,(H,12,14)(H3,11,13,17) |
| InChIKey | LFAVCMQGAWVRJS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea?
The IUPAC name of (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea (CID 2851929) is (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea.
What is the SMILES notation for (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea?
The canonical SMILES for (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea is NC(=S)NNC(=O)C1COc2ccccc2O1.
What is the InChIKey of (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea?
The InChIKey is LFAVCMQGAWVRJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O3S/c11-10(17)13-12-9(14)8-5-15-6-3-1-2-4-7(6)16-8/h1-4,8H,5H2,(H,12,14)(H3,11,13,17).
What are the key properties of (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea?
(2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea has a molecular weight of 253.28 g/mol, XLogP of -0.31, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dihydro-1,4-benzodioxine-3-carbonylamino)thiourea is sourced from PubChem (CID 2851929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).