C11H18N6 — CID 2851932
N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]-2H-tetrazol-5-amine (PubChem CID 2851932) has the molecular formula C11H18N6 and a molecular weight of 234.31 g/mol. Its IUPAC name is N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]-2H-tetrazol-5-amine.
| Compound Name | N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 2851932 |
| Molecular Formula | C11H18N6 |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | N-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]-2H-tetrazol-5-amine |
| SMILES | CC12CCC(CC1=NNc1nn[nH]n1)C2(C)C |
| InChI | InChI=1S/C11H18N6/c1-10(2)7-4-5-11(10,3)8(6-7)12-13-9-14-16-17-15-9/h7H,4-6H2,1-3H3,(H2,13,14,15,16,17) |
| InChIKey | RJEDFHYKZQUSQN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|