About 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide
4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 2851975) has the molecular formula C15H21NO3S
and a molecular weight of 295.40 g/mol. Its IUPAC name is 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide |
| PubChem CID | 2851975 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C15H21NO3S/c1-15(2,3)12-6-4-11(5-7-12)14(17)16-13-8-9-20(18,19)10-13/h4-7,13H,8-10H2,1-3H3,(H,16,17) |
| InChIKey | CORAFMLYOWUDQE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide?
The IUPAC name of 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide (CID 2851975) is 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide.
What is the SMILES notation for 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide?
The canonical SMILES for 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide is CC(C)(C)c1ccc(C(=O)NC2CCS(=O)(=O)C2)cc1.
What is the InChIKey of 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide?
The InChIKey is CORAFMLYOWUDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3S/c1-15(2,3)12-6-4-11(5-7-12)14(17)16-13-8-9-20(18,19)10-13/h4-7,13H,8-10H2,1-3H3,(H,16,17).
What are the key properties of 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide?
4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide has a molecular weight of 295.40 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-(1,1-dioxothiolan-3-yl)benzamide is sourced from PubChem (CID 2851975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).