C25H23NO2 — CID 2852023
7,7-dimethyl-10-(3-methylphenyl)-6,8,10,10a-tetrahydroindeno[1,2-b]quinoline-9,11-dione (PubChem CID 2852023) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 7,7-dimethyl-10-(3-methylphenyl)-6,8,10,10a-tetrahydroindeno[1,2-b]quinoline-9,11-dione.
| Compound Name | 7,7-dimethyl-10-(3-methylphenyl)-6,8,10,10a-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
|---|---|
| PubChem CID | 2852023 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 7,7-dimethyl-10-(3-methylphenyl)-6,8,10,10a-tetrahydroindeno[1,2-b]quinoline-9,11-dione |
| SMILES | Cc1cccc(C2C3=C(CC(C)(C)CC3=O)N=C3c4ccccc4C(=O)C32)c1 |
| InChI | InChI=1S/C25H23NO2/c1-14-7-6-8-15(11-14)20-21-18(12-25(2,3)13-19(21)27)26-23-16-9-4-5-10-17(16)24(28)22(20)23/h4-11,20,22H,12-13H2,1-3H3 |
| InChIKey | JMGYMTPWXNAQKQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_B(1)', 'substructure': 'N/A'} |
|---|