C12H16F8N2O — CID 2852094
N-(2,2,3,3,4,4,5,5-octafluoro-1-piperidin-1-ylpentyl)acetamide (PubChem CID 2852094) has the molecular formula C12H16F8N2O and a molecular weight of 356.26 g/mol. Its IUPAC name is N-(2,2,3,3,4,4,5,5-octafluoro-1-piperidin-1-ylpentyl)acetamide.
| Compound Name | N-(2,2,3,3,4,4,5,5-octafluoro-1-piperidin-1-ylpentyl)acetamide |
|---|---|
| PubChem CID | 2852094 |
| Molecular Formula | C12H16F8N2O |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | N-(2,2,3,3,4,4,5,5-octafluoro-1-piperidin-1-ylpentyl)acetamide |
| SMILES | CC(=O)NC(N1CCCCC1)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H16F8N2O/c1-7(23)21-9(22-5-3-2-4-6-22)11(17,18)12(19,20)10(15,16)8(13)14/h8-9H,2-6H2,1H3,(H,21,23) |
| InChIKey | FHLMWTNXCBZALF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|