About 1,3-diphenylpropylurea
1,3-diphenylpropylurea (PubChem CID 2852115) has the molecular formula C16H18N2O
and a molecular weight of 254.33 g/mol. Its IUPAC name is 1,3-diphenylpropylurea.
Molecular Properties
| Compound Name | 1,3-diphenylpropylurea |
| PubChem CID | 2852115 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1,3-diphenylpropylurea |
| SMILES | NC(=O)NC(CCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O/c17-16(19)18-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H3,17,18,19) |
| InChIKey | GAHGUTQKHNHYJG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-diphenylpropylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diphenylpropylurea?
The IUPAC name of 1,3-diphenylpropylurea (CID 2852115) is 1,3-diphenylpropylurea.
What is the SMILES notation for 1,3-diphenylpropylurea?
The canonical SMILES for 1,3-diphenylpropylurea is NC(=O)NC(CCc1ccccc1)c1ccccc1.
What is the InChIKey of 1,3-diphenylpropylurea?
The InChIKey is GAHGUTQKHNHYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O/c17-16(19)18-15(14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-10,15H,11-12H2,(H3,17,18,19).
What are the key properties of 1,3-diphenylpropylurea?
1,3-diphenylpropylurea has a molecular weight of 254.33 g/mol, XLogP of 3.03, 5 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diphenylpropylurea is sourced from PubChem (CID 2852115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).