C24H24BrN3O4 — CID 2852124
2-[1-methyl-2-(2,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridin-5-ium-5-yl]-1-phenylethanone bromide (PubChem CID 2852124) has the molecular formula C24H24BrN3O4 and a molecular weight of 498.38 g/mol. Its IUPAC name is 2-[1-methyl-2-(2,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridin-5-ium-5-yl]-1-phenylethanone bromide.
| Compound Name | 2-[1-methyl-2-(2,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridin-5-ium-5-yl]-1-phenylethanone bromide |
|---|---|
| PubChem CID | 2852124 |
| Molecular Formula | C24H24BrN3O4 |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 2-[1-methyl-2-(2,4,5-trimethoxyphenyl)imidazo[4,5-c]pyridin-5-ium-5-yl]-1-phenylethanone bromide |
| SMILES | COc1cc(OC)c(-c2nc3c[n+](CC(=O)c4ccccc4)ccc3n2C)cc1OC.[Br-] |
| InChI | InChI=1S/C24H24N3O4.BrH/c1-26-19-10-11-27(15-20(28)16-8-6-5-7-9-16)14-18(19)25-24(26)17-12-22(30-3)23(31-4)13-21(17)29-2;/h5-14H,15H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | DKWVFMIFZZGTGE-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|