About 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide
2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide (PubChem CID 2852153) has the molecular formula C10H14IN3
and a molecular weight of 303.15 g/mol. Its IUPAC name is 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide.
Molecular Properties
| Compound Name | 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide |
| PubChem CID | 2852153 |
| Molecular Formula | C10H14IN3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide |
| SMILES | C[N+]1(c2ccccc2)CCC(N)=N1.[I-] |
| InChI | InChI=1S/C10H14N3.HI/c1-13(8-7-10(11)12-13)9-5-3-2-4-6-9;/h2-6H,7-8H2,1H3,(H2,11,12);1H/q+1;/p-1 |
| InChIKey | JMXACMILHGTPPM-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide?
The IUPAC name of 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide (CID 2852153) is 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide.
What is the SMILES notation for 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide?
The canonical SMILES for 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide is C[N+]1(c2ccccc2)CCC(N)=N1.[I-].
What is the InChIKey of 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide?
The InChIKey is JMXACMILHGTPPM-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H14N3.HI/c1-13(8-7-10(11)12-13)9-5-3-2-4-6-9;/h2-6H,7-8H2,1H3,(H2,11,12);1H/q+1;/p-1.
What are the key properties of 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide?
2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide has a molecular weight of 303.15 g/mol, XLogP of -1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-phenyl-3,4-dihydropyrazol-2-ium-5-amine iodide is sourced from PubChem (CID 2852153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).