About 1-phenylbutan-2-ylurea
1-phenylbutan-2-ylurea (PubChem CID 2852730) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-phenylbutan-2-ylurea.
Molecular Properties
| Compound Name | 1-phenylbutan-2-ylurea |
| PubChem CID | 2852730 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-phenylbutan-2-ylurea |
| SMILES | CCC(Cc1ccccc1)NC(N)=O |
| InChI | InChI=1S/C11H16N2O/c1-2-10(13-11(12)14)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H3,12,13,14) |
| InChIKey | GZHXWVYCJHBMBX-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylbutan-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylbutan-2-ylurea?
The IUPAC name of 1-phenylbutan-2-ylurea (CID 2852730) is 1-phenylbutan-2-ylurea.
What is the SMILES notation for 1-phenylbutan-2-ylurea?
The canonical SMILES for 1-phenylbutan-2-ylurea is CCC(Cc1ccccc1)NC(N)=O.
What is the InChIKey of 1-phenylbutan-2-ylurea?
The InChIKey is GZHXWVYCJHBMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c1-2-10(13-11(12)14)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3,(H3,12,13,14).
What are the key properties of 1-phenylbutan-2-ylurea?
1-phenylbutan-2-ylurea has a molecular weight of 192.26 g/mol, XLogP of 1.68, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylbutan-2-ylurea is sourced from PubChem (CID 2852730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).