About 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one
2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one (PubChem CID 2852893) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one |
| PubChem CID | 2852893 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one |
| SMILES | CCC1(Cc2ccccc2)NC(=O)c2ccccc2O1 |
| InChI | InChI=1S/C17H17NO2/c1-2-17(12-13-8-4-3-5-9-13)18-16(19)14-10-6-7-11-15(14)20-17/h3-11H,2,12H2,1H3,(H,18,19) |
| InChIKey | CXVCOIDGWFPMBV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one?
The IUPAC name of 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one (CID 2852893) is 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one.
What is the SMILES notation for 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one?
The canonical SMILES for 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one is CCC1(Cc2ccccc2)NC(=O)c2ccccc2O1.
What is the InChIKey of 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one?
The InChIKey is CXVCOIDGWFPMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO2/c1-2-17(12-13-8-4-3-5-9-13)18-16(19)14-10-6-7-11-15(14)20-17/h3-11H,2,12H2,1H3,(H,18,19).
What are the key properties of 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one?
2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one has a molecular weight of 267.33 g/mol, XLogP of 3.16, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-2-ethyl-3H-1,3-benzoxazin-4-one is sourced from PubChem (CID 2852893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).