C14H12Cl2N2O3 — CID 28529893
5-chloro-6-(4-chloro-2-methoxy-5-methylanilino)pyridine-3-carboxylic acid (PubChem CID 28529893) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is 5-chloro-6-(4-chloro-2-methoxy-5-methylanilino)pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-(4-chloro-2-methoxy-5-methylanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 28529893 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 5-chloro-6-(4-chloro-2-methoxy-5-methylanilino)pyridine-3-carboxylic acid |
| SMILES | COc1cc(Cl)c(C)cc1Nc1ncc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C14H12Cl2N2O3/c1-7-3-11(12(21-2)5-9(7)15)18-13-10(16)4-8(6-17-13)14(19)20/h3-6H,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | QFJAWYUDPKLLMG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |