C13H14F4O3 — CID 2853155
ethyl 4,4,5,5-tetrafluoro-3-hydroxy-3-phenylpentanoate (PubChem CID 2853155) has the molecular formula C13H14F4O3 and a molecular weight of 294.24 g/mol. Its IUPAC name is ethyl 4,4,5,5-tetrafluoro-3-hydroxy-3-phenylpentanoate.
| Compound Name | ethyl 4,4,5,5-tetrafluoro-3-hydroxy-3-phenylpentanoate |
|---|---|
| PubChem CID | 2853155 |
| Molecular Formula | C13H14F4O3 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | ethyl 4,4,5,5-tetrafluoro-3-hydroxy-3-phenylpentanoate |
| SMILES | CCOC(=O)CC(O)(c1ccccc1)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H14F4O3/c1-2-20-10(18)8-12(19,13(16,17)11(14)15)9-6-4-3-5-7-9/h3-7,11,19H,2,8H2,1H3 |
| InChIKey | OPRWXZJDJKVTRC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|