About (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate
(2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate (PubChem CID 2853781) has the molecular formula C12H14BrNO2S3
and a molecular weight of 380.35 g/mol. Its IUPAC name is (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate.
Molecular Properties
| Compound Name | (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
| PubChem CID | 2853781 |
| Molecular Formula | C12H14BrNO2S3 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate |
| SMILES | O=S1(=O)CCC(NC(=S)SCc2ccccc2Br)C1 |
| InChI | InChI=1S/C12H14BrNO2S3/c13-11-4-2-1-3-9(11)7-18-12(17)14-10-5-6-19(15,16)8-10/h1-4,10H,5-8H2,(H,14,17) |
| InChIKey | UTLJHPMPJMKBNK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
The IUPAC name of (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate (CID 2853781) is (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate.
What is the SMILES notation for (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
The canonical SMILES for (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate is O=S1(=O)CCC(NC(=S)SCc2ccccc2Br)C1.
What is the InChIKey of (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
The InChIKey is UTLJHPMPJMKBNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO2S3/c13-11-4-2-1-3-9(11)7-18-12(17)14-10-5-6-19(15,16)8-10/h1-4,10H,5-8H2,(H,14,17).
What are the key properties of (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate?
(2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate has a molecular weight of 380.35 g/mol, XLogP of 2.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)methyl N-(1,1-dioxothiolan-3-yl)carbamodithioate is sourced from PubChem (CID 2853781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).