C23H24N2O4S — CID 28541649
(2R)-2-[(4-methoxy-3-methylphenyl)sulfonylamino]-N,3-diphenylpropanamide (PubChem CID 28541649) has the molecular formula C23H24N2O4S and a molecular weight of 424.52 g/mol. Its IUPAC name is (2R)-2-[(4-methoxy-3-methylphenyl)sulfonylamino]-N,3-diphenylpropanamide.
| Compound Name | (2R)-2-[(4-methoxy-3-methylphenyl)sulfonylamino]-N,3-diphenylpropanamide |
|---|---|
| PubChem CID | 28541649 |
| Molecular Formula | C23H24N2O4S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (2R)-2-[(4-methoxy-3-methylphenyl)sulfonylamino]-N,3-diphenylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)Nc2ccccc2)cc1C |
| InChI | InChI=1S/C23H24N2O4S/c1-17-15-20(13-14-22(17)29-2)30(27,28)25-21(16-18-9-5-3-6-10-18)23(26)24-19-11-7-4-8-12-19/h3-15,21,25H,16H2,1-2H3,(H,24,26)/t21-/m1/s1 |
| InChIKey | YSAALRRAVGXTRH-OAQYLSRUSA-N |
| XLogP | 3.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |