C15H13ClF3N — CID 28542855
2-chloro-N-[(3-methylphenyl)methyl]-5-(trifluoromethyl)aniline (PubChem CID 28542855) has the molecular formula C15H13ClF3N and a molecular weight of 299.72 g/mol. Its IUPAC name is 2-chloro-N-[(3-methylphenyl)methyl]-5-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-[(3-methylphenyl)methyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 28542855 |
| Molecular Formula | C15H13ClF3N |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-chloro-N-[(3-methylphenyl)methyl]-5-(trifluoromethyl)aniline |
| SMILES | Cc1cccc(CNc2cc(C(F)(F)F)ccc2Cl)c1 |
| InChI | InChI=1S/C15H13ClF3N/c1-10-3-2-4-11(7-10)9-20-14-8-12(15(17,18)19)5-6-13(14)16/h2-8,20H,9H2,1H3 |
| InChIKey | DYLGUECZJJGUFQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |