C23H22ClN3O6S — CID 28542970
(2S)-2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-N-(2-methyl-5-nitrophenyl)-3-phenylpropanamide (PubChem CID 28542970) has the molecular formula C23H22ClN3O6S and a molecular weight of 503.96 g/mol. Its IUPAC name is (2S)-2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-N-(2-methyl-5-nitrophenyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-N-(2-methyl-5-nitrophenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 28542970 |
| Molecular Formula | C23H22ClN3O6S |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | (2S)-2-[(5-chloro-2-methoxyphenyl)sulfonylamino]-N-(2-methyl-5-nitrophenyl)-3-phenylpropanamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C23H22ClN3O6S/c1-15-8-10-18(27(29)30)14-19(15)25-23(28)20(12-16-6-4-3-5-7-16)26-34(31,32)22-13-17(24)9-11-21(22)33-2/h3-11,13-14,20,26H,12H2,1-2H3,(H,25,28)/t20-/m0/s1 |
| InChIKey | FFQFIAADZIVXLL-FQEVSTJZSA-N |
| XLogP | 4.09 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|