C10H11NO3 — CID 28545450
1-[(E)-but-2-enyl]-6-oxopyridine-3-carboxylic acid (PubChem CID 28545450) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]-6-oxopyridine-3-carboxylic acid.
| Compound Name | 1-[(E)-but-2-enyl]-6-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 28545450 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 1-[(E)-but-2-enyl]-6-oxopyridine-3-carboxylic acid |
| SMILES | C/C=C/Cn1cc(C(=O)O)ccc1=O |
| InChI | InChI=1S/C10H11NO3/c1-2-3-6-11-7-8(10(13)14)4-5-9(11)12/h2-5,7H,6H2,1H3,(H,13,14)/b3-2+ |
| InChIKey | GDCATANJGVAZGZ-NSCUHMNNSA-N |
| XLogP | 1.12 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|