C15H15N3S — CID 28545864
2-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3H-benzimidazol-5-amine (PubChem CID 28545864) has the molecular formula C15H15N3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3H-benzimidazol-5-amine.
| Compound Name | 2-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3H-benzimidazol-5-amine |
|---|---|
| PubChem CID | 28545864 |
| Molecular Formula | C15H15N3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 2-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3H-benzimidazol-5-amine |
| SMILES | Nc1ccc2nc(-c3cc4c(s3)CCCC4)[nH]c2c1 |
| InChI | InChI=1S/C15H15N3S/c16-10-5-6-11-12(8-10)18-15(17-11)14-7-9-3-1-2-4-13(9)19-14/h5-8H,1-4,16H2,(H,17,18) |
| InChIKey | VJWJPGXLEANAJL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|